C24H37N3O3 — CID 53053127
3-(pentanoylamino)-4-[4-(2-piperidin-1-ylethyl)piperidin-1-yl]benzoic acid (PubChem CID 53053127) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is 3-(pentanoylamino)-4-[4-(2-piperidin-1-ylethyl)piperidin-1-yl]benzoic acid.
| Compound Name | 3-(pentanoylamino)-4-[4-(2-piperidin-1-ylethyl)piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 53053127 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | 3-(pentanoylamino)-4-[4-(2-piperidin-1-ylethyl)piperidin-1-yl]benzoic acid |
| SMILES | CCCCC(=O)Nc1cc(C(=O)O)ccc1N1CCC(CCN2CCCCC2)CC1 |
| InChI | InChI=1S/C24H37N3O3/c1-2-3-7-23(28)25-21-18-20(24(29)30)8-9-22(21)27-16-11-19(12-17-27)10-15-26-13-5-4-6-14-26/h8-9,18-19H,2-7,10-17H2,1H3,(H,25,28)(H,29,30) |
| InChIKey | MJIJMSGQNUJNQL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |