C16H23N5O3S — CID 53053748
N-(3-ethoxypropyl)-7-oxo-2-piperidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5-carboxamide (PubChem CID 53053748) has the molecular formula C16H23N5O3S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-7-oxo-2-piperidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-7-oxo-2-piperidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 53053748 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-(3-ethoxypropyl)-7-oxo-2-piperidin-1-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5-carboxamide |
| SMILES | CCOCCCNC(=O)c1cc(=O)nc2sc(N3CCCCC3)nn12 |
| InChI | InChI=1S/C16H23N5O3S/c1-2-24-10-6-7-17-14(23)12-11-13(22)18-15-21(12)19-16(25-15)20-8-4-3-5-9-20/h11H,2-10H2,1H3,(H,17,23) |
| InChIKey | KKXUWQIFSRIHNN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|