About 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid
5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid (PubChem CID 53056667) has the molecular formula C18H21N3O4S
and a molecular weight of 375.45 g/mol. Its IUPAC name is 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid |
| PubChem CID | 53056667 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cnc(N3CCCC3)c(C(=O)O)c2)c(C)c1 |
| InChI | InChI=1S/C18H21N3O4S/c1-12-5-6-16(13(2)9-12)26(24,25)20-14-10-15(18(22)23)17(19-11-14)21-7-3-4-8-21/h5-6,9-11,20H,3-4,7-8H2,1-2H3,(H,22,23) |
| InChIKey | CIGGVGZTVFCWHQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid?
The IUPAC name of 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid (CID 53056667) is 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid.
What is the SMILES notation for 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid?
The canonical SMILES for 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid is Cc1ccc(S(=O)(=O)Nc2cnc(N3CCCC3)c(C(=O)O)c2)c(C)c1.
What is the InChIKey of 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid?
The InChIKey is CIGGVGZTVFCWHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O4S/c1-12-5-6-16(13(2)9-12)26(24,25)20-14-10-15(18(22)23)17(19-11-14)21-7-3-4-8-21/h5-6,9-11,20H,3-4,7-8H2,1-2H3,(H,22,23).
What are the key properties of 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid?
5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid has a molecular weight of 375.45 g/mol, XLogP of 2.80, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-dimethylphenyl)sulfonylamino]-2-pyrrolidin-1-ylpyridine-3-carboxylic acid is sourced from PubChem (CID 53056667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).