About 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide
2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 53057396) has the molecular formula C20H21ClN2O3
and a molecular weight of 372.85 g/mol. Its IUPAC name is 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide.
Molecular Properties
| Compound Name | 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide |
| PubChem CID | 53057396 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CN2C(=O)C(C)(C)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-20(2)16-10-14(21)6-9-17(16)23(19(20)25)12-18(24)22-11-13-4-7-15(26-3)8-5-13/h4-10H,11-12H2,1-3H3,(H,22,24) |
| InChIKey | HWSZNQYUALRNHB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide?
The IUPAC name of 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide (CID 53057396) is 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide.
What is the SMILES notation for 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide?
The canonical SMILES for 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide is COc1ccc(CNC(=O)CN2C(=O)C(C)(C)c3cc(Cl)ccc32)cc1.
What is the InChIKey of 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide?
The InChIKey is HWSZNQYUALRNHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClN2O3/c1-20(2)16-10-14(21)6-9-17(16)23(19(20)25)12-18(24)22-11-13-4-7-15(26-3)8-5-13/h4-10H,11-12H2,1-3H3,(H,22,24).
What are the key properties of 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide?
2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide has a molecular weight of 372.85 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-3,3-dimethyl-2-oxoindol-1-yl)-N-[(4-methoxyphenyl)methyl]acetamide is sourced from PubChem (CID 53057396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).