C20H21ClN2O2 — CID 53057430
N-[(4-chlorophenyl)methyl]-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide (PubChem CID 53057430) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 53057430 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(=O)N2CC(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O2/c1-13-4-9-17-16(10-13)20(2,3)19(25)23(17)12-18(24)22-11-14-5-7-15(21)8-6-14/h4-10H,11-12H2,1-3H3,(H,22,24) |
| InChIKey | IONFENVGSZEQDP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |