About 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide
1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide (PubChem CID 5305744) has the molecular formula C19H19N3O4
and a molecular weight of 353.38 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide.
Molecular Properties
| Compound Name | 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide |
| PubChem CID | 5305744 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide |
| SMILES | Cn1c(=O)c2cc(C(=O)NCCOc3ccccc3)ccc2n(C)c1=O |
| InChI | InChI=1S/C19H19N3O4/c1-21-16-9-8-13(12-15(16)18(24)22(2)19(21)25)17(23)20-10-11-26-14-6-4-3-5-7-14/h3-9,12H,10-11H2,1-2H3,(H,20,23) |
| InChIKey | BGAFFZJHIZWIRK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide?
The IUPAC name of 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide (CID 5305744) is 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide.
What is the SMILES notation for 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide?
The canonical SMILES for 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide is Cn1c(=O)c2cc(C(=O)NCCOc3ccccc3)ccc2n(C)c1=O.
What is the InChIKey of 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide?
The InChIKey is BGAFFZJHIZWIRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O4/c1-21-16-9-8-13(12-15(16)18(24)22(2)19(21)25)17(23)20-10-11-26-14-6-4-3-5-7-14/h3-9,12H,10-11H2,1-2H3,(H,20,23).
What are the key properties of 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide?
1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide has a molecular weight of 353.38 g/mol, XLogP of 1.05, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-2,4-dioxo-N-(2-phenoxyethyl)quinazoline-6-carboxamide is sourced from PubChem (CID 5305744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).