C18H11F6NO4 — CID 5305756
4-(1,2,2,3,3,3-hexafluoropropoxy)-N-(1-oxo-3H-2-benzofuran-5-yl)benzamide (PubChem CID 5305756) has the molecular formula C18H11F6NO4 and a molecular weight of 419.28 g/mol. Its IUPAC name is 4-(1,2,2,3,3,3-hexafluoropropoxy)-N-(1-oxo-3H-2-benzofuran-5-yl)benzamide.
| Compound Name | 4-(1,2,2,3,3,3-hexafluoropropoxy)-N-(1-oxo-3H-2-benzofuran-5-yl)benzamide |
|---|---|
| PubChem CID | 5305756 |
| Molecular Formula | C18H11F6NO4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 4-(1,2,2,3,3,3-hexafluoropropoxy)-N-(1-oxo-3H-2-benzofuran-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)COC2=O)c1ccc(OC(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H11F6NO4/c19-16(17(20,21)18(22,23)24)29-12-4-1-9(2-5-12)14(26)25-11-3-6-13-10(7-11)8-28-15(13)27/h1-7,16H,8H2,(H,25,26) |
| InChIKey | MQYXIDMEMYDZGW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|