C22H19N3O2S — CID 53058343
1-benzyl-3-methyl-2-oxo-N-(thiophen-2-ylmethyl)quinoxaline-6-carboxamide (PubChem CID 53058343) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is 1-benzyl-3-methyl-2-oxo-N-(thiophen-2-ylmethyl)quinoxaline-6-carboxamide.
| Compound Name | 1-benzyl-3-methyl-2-oxo-N-(thiophen-2-ylmethyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 53058343 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-benzyl-3-methyl-2-oxo-N-(thiophen-2-ylmethyl)quinoxaline-6-carboxamide |
| SMILES | Cc1nc2cc(C(=O)NCc3cccs3)ccc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C22H19N3O2S/c1-15-22(27)25(14-16-6-3-2-4-7-16)20-10-9-17(12-19(20)24-15)21(26)23-13-18-8-5-11-28-18/h2-12H,13-14H2,1H3,(H,23,26) |
| InChIKey | XTKKVIUXYXUEDL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |