About 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one
4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one (PubChem CID 53060604) has the molecular formula C20H13BrClFN2OS
and a molecular weight of 463.76 g/mol. Its IUPAC name is 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one |
| PubChem CID | 53060604 |
| Molecular Formula | C20H13BrClFN2OS |
| Molecular Weight | 463.76 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one |
| SMILES | O=C1CC(c2ccc(Br)s2)=Nc2ccccc2N1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H13BrClFN2OS/c21-19-9-8-18(27-19)16-10-20(26)25(17-7-2-1-6-15(17)24-16)11-12-13(22)4-3-5-14(12)23/h1-9H,10-11H2 |
| InChIKey | RJOVMJHJGKZYLD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.76 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one?
The IUPAC name of 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one (CID 53060604) is 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one.
What is the SMILES notation for 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one?
The canonical SMILES for 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one is O=C1CC(c2ccc(Br)s2)=Nc2ccccc2N1Cc1c(F)cccc1Cl.
What is the InChIKey of 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one?
The InChIKey is RJOVMJHJGKZYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13BrClFN2OS/c21-19-9-8-18(27-19)16-10-20(26)25(17-7-2-1-6-15(17)24-16)11-12-13(22)4-3-5-14(12)23/h1-9H,10-11H2.
What are the key properties of 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one?
4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one has a molecular weight of 463.76 g/mol, XLogP of 6.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromothiophen-2-yl)-1-[(2-chloro-6-fluorophenyl)methyl]-3H-1,5-benzodiazepin-2-one is sourced from PubChem (CID 53060604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).