About 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one
7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one (PubChem CID 53060708) has the molecular formula C23H22N2OS
and a molecular weight of 374.51 g/mol. Its IUPAC name is 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one |
| PubChem CID | 53060708 |
| Molecular Formula | C23H22N2OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one |
| SMILES | Cc1cccc(CN2C(=O)CC(c3cccs3)=Nc3cc(C)c(C)cc32)c1 |
| InChI | InChI=1S/C23H22N2OS/c1-15-6-4-7-18(10-15)14-25-21-12-17(3)16(2)11-19(21)24-20(13-23(25)26)22-8-5-9-27-22/h4-12H,13-14H2,1-3H3 |
| InChIKey | WNKSVHXYXATDNB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one?
The IUPAC name of 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one (CID 53060708) is 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one.
What is the SMILES notation for 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one?
The canonical SMILES for 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one is Cc1cccc(CN2C(=O)CC(c3cccs3)=Nc3cc(C)c(C)cc32)c1.
What is the InChIKey of 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one?
The InChIKey is WNKSVHXYXATDNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2OS/c1-15-6-4-7-18(10-15)14-25-21-12-17(3)16(2)11-19(21)24-20(13-23(25)26)22-8-5-9-27-22/h4-12H,13-14H2,1-3H3.
What are the key properties of 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one?
7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one has a molecular weight of 374.51 g/mol, XLogP of 5.73, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethyl-1-[(3-methylphenyl)methyl]-4-thiophen-2-yl-3H-1,5-benzodiazepin-2-one is sourced from PubChem (CID 53060708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).