C16H19ClN2O3 — CID 53063017
methyl 8-chloro-4-(3-methylbutylamino)-2-oxo-1H-quinoline-3-carboxylate (PubChem CID 53063017) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is methyl 8-chloro-4-(3-methylbutylamino)-2-oxo-1H-quinoline-3-carboxylate.
| Compound Name | methyl 8-chloro-4-(3-methylbutylamino)-2-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 53063017 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | methyl 8-chloro-4-(3-methylbutylamino)-2-oxo-1H-quinoline-3-carboxylate |
| SMILES | COC(=O)c1c(NCCC(C)C)c2cccc(Cl)c2[nH]c1=O |
| InChI | InChI=1S/C16H19ClN2O3/c1-9(2)7-8-18-14-10-5-4-6-11(17)13(10)19-15(20)12(14)16(21)22-3/h4-6,9H,7-8H2,1-3H3,(H2,18,19,20) |
| InChIKey | UNPQFKQHYDBZNX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |