C25H19ClN2O4 — CID 5306316
2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoacetamide (PubChem CID 5306316) has the molecular formula C25H19ClN2O4 and a molecular weight of 446.89 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoacetamide.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 5306316 |
| Molecular Formula | C25H19ClN2O4 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoacetamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)C(=O)c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H19ClN2O4/c26-17-7-5-16(6-8-17)14-28-15-20(19-3-1-2-4-21(19)28)24(29)25(30)27-18-9-10-22-23(13-18)32-12-11-31-22/h1-10,13,15H,11-12,14H2,(H,27,30) |
| InChIKey | BLBODFKTFONFEC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|