C18H21N3O2S — CID 53063187
N-[2-[2-(4-methylphenyl)benzimidazol-1-yl]ethyl]ethanesulfonamide (PubChem CID 53063187) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[2-[2-(4-methylphenyl)benzimidazol-1-yl]ethyl]ethanesulfonamide.
| Compound Name | N-[2-[2-(4-methylphenyl)benzimidazol-1-yl]ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 53063187 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[2-[2-(4-methylphenyl)benzimidazol-1-yl]ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCn1c(-c2ccc(C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C18H21N3O2S/c1-3-24(22,23)19-12-13-21-17-7-5-4-6-16(17)20-18(21)15-10-8-14(2)9-11-15/h4-11,19H,3,12-13H2,1-2H3 |
| InChIKey | QKWCTRKLDNPTJK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |