C20H27N3O3 — CID 53063791
1-[(4-methylphenyl)methyl]-4-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazine-2,3-dione (PubChem CID 53063791) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-4-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazine-2,3-dione.
| Compound Name | 1-[(4-methylphenyl)methyl]-4-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 53063791 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-4-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazine-2,3-dione |
| SMILES | Cc1ccc(CN2CCN(CC(=O)N3CCC(C)CC3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-15-3-5-17(6-4-15)13-22-11-12-23(20(26)19(22)25)14-18(24)21-9-7-16(2)8-10-21/h3-6,16H,7-14H2,1-2H3 |
| InChIKey | LZIYZQUAMLSWJR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|