C23H27N5O5S — CID 53064394
ethyl 3-[3-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)propanoylamino]benzoate (PubChem CID 53064394) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is ethyl 3-[3-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)propanoylamino]benzoate.
| Compound Name | ethyl 3-[3-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 53064394 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | ethyl 3-[3-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)propanoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)CCn2nnc3cc(S(=O)(=O)N4CCCCC4)ccc32)c1 |
| InChI | InChI=1S/C23H27N5O5S/c1-2-33-23(30)17-7-6-8-18(15-17)24-22(29)11-14-28-21-10-9-19(16-20(21)25-26-28)34(31,32)27-12-4-3-5-13-27/h6-10,15-16H,2-5,11-14H2,1H3,(H,24,29) |
| InChIKey | JLFGWLNDEIPVNH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |