C13H12F3NO2 — CID 5306473
1-(2-benzoylpyrrolidin-1-yl)-2,2,2-trifluoroethanone (PubChem CID 5306473) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 1-(2-benzoylpyrrolidin-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(2-benzoylpyrrolidin-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 5306473 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1-(2-benzoylpyrrolidin-1-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccccc1)C1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO2/c14-13(15,16)12(19)17-8-4-7-10(17)11(18)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2 |
| InChIKey | KCYAKUNXGJHKNG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |