C27H26FN5O2 — CID 53070039
4-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(4-fluorophenyl)methyl]piperazine-1-carboxamide (PubChem CID 53070039) has the molecular formula C27H26FN5O2 and a molecular weight of 471.54 g/mol. Its IUPAC name is 4-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(4-fluorophenyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(4-fluorophenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 53070039 |
| Molecular Formula | C27H26FN5O2 |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 4-(4-benzyl-3-oxoquinoxalin-2-yl)-N-[(4-fluorophenyl)methyl]piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)N1CCN(c2nc3ccccc3n(Cc3ccccc3)c2=O)CC1 |
| InChI | InChI=1S/C27H26FN5O2/c28-22-12-10-20(11-13-22)18-29-27(35)32-16-14-31(15-17-32)25-26(34)33(19-21-6-2-1-3-7-21)24-9-5-4-8-23(24)30-25/h1-13H,14-19H2,(H,29,35) |
| InChIKey | VVVAXGFCTJRRJW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |