C23H26N4O2 — CID 53070339
1-(4-methyl-3-oxoquinoxalin-2-yl)-N-[(2-methylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 53070339) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-(4-methyl-3-oxoquinoxalin-2-yl)-N-[(2-methylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-methyl-3-oxoquinoxalin-2-yl)-N-[(2-methylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53070339 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-(4-methyl-3-oxoquinoxalin-2-yl)-N-[(2-methylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cc1ccccc1CNC(=O)C1CCCN(c2nc3ccccc3n(C)c2=O)C1 |
| InChI | InChI=1S/C23H26N4O2/c1-16-8-3-4-9-17(16)14-24-22(28)18-10-7-13-27(15-18)21-23(29)26(2)20-12-6-5-11-19(20)25-21/h3-6,8-9,11-12,18H,7,10,13-15H2,1-2H3,(H,24,28) |
| InChIKey | DPTQKJXFLOEOPV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |