About 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine
4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine (PubChem CID 53071521) has the molecular formula C21H20F2N4O3S
and a molecular weight of 446.48 g/mol. Its IUPAC name is 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine.
Molecular Properties
| Compound Name | 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine |
| PubChem CID | 53071521 |
| Molecular Formula | C21H20F2N4O3S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine |
| SMILES | COc1ccc(-c2cc(N3CCN(S(=O)(=O)c4cc(F)ccc4F)CC3)ncn2)cc1 |
| InChI | InChI=1S/C21H20F2N4O3S/c1-30-17-5-2-15(3-6-17)19-13-21(25-14-24-19)26-8-10-27(11-9-26)31(28,29)20-12-16(22)4-7-18(20)23/h2-7,12-14H,8-11H2,1H3 |
| InChIKey | XLXKWARDVVPDPP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine?
The IUPAC name of 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine (CID 53071521) is 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine.
What is the SMILES notation for 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine?
The canonical SMILES for 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine is COc1ccc(-c2cc(N3CCN(S(=O)(=O)c4cc(F)ccc4F)CC3)ncn2)cc1.
What is the InChIKey of 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine?
The InChIKey is XLXKWARDVVPDPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F2N4O3S/c1-30-17-5-2-15(3-6-17)19-13-21(25-14-24-19)26-8-10-27(11-9-26)31(28,29)20-12-16(22)4-7-18(20)23/h2-7,12-14H,8-11H2,1H3.
What are the key properties of 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine?
4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine has a molecular weight of 446.48 g/mol, XLogP of 2.94, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine is sourced from PubChem (CID 53071521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).