C15H21N3O3S — CID 53072028
4-[1-(4-ethylphenyl)sulfonyl-4,5-dihydroimidazol-2-yl]morpholine (PubChem CID 53072028) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 4-[1-(4-ethylphenyl)sulfonyl-4,5-dihydroimidazol-2-yl]morpholine.
| Compound Name | 4-[1-(4-ethylphenyl)sulfonyl-4,5-dihydroimidazol-2-yl]morpholine |
|---|---|
| PubChem CID | 53072028 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-[1-(4-ethylphenyl)sulfonyl-4,5-dihydroimidazol-2-yl]morpholine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN=C2N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H21N3O3S/c1-2-13-3-5-14(6-4-13)22(19,20)18-8-7-16-15(18)17-9-11-21-12-10-17/h3-6H,2,7-12H2,1H3 |
| InChIKey | KREWHCXIZWPDTL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |