C22H22F2N4O3S2 — CID 53072841
N-(2,4-difluorophenyl)-5-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidin-2-yl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 53072841) has the molecular formula C22H22F2N4O3S2 and a molecular weight of 492.57 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidin-2-yl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-5-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidin-2-yl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 53072841 |
| Molecular Formula | C22H22F2N4O3S2 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-[1-(2,4,6-trimethylphenyl)sulfonylpyrrolidin-2-yl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCCC2c2nnc(C(=O)Nc3ccc(F)cc3F)s2)c(C)c1 |
| InChI | InChI=1S/C22H22F2N4O3S2/c1-12-9-13(2)19(14(3)10-12)33(30,31)28-8-4-5-18(28)21-26-27-22(32-21)20(29)25-17-7-6-15(23)11-16(17)24/h6-7,9-11,18H,4-5,8H2,1-3H3,(H,25,29) |
| InChIKey | ZZCQRQDFLOSXOS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |