About N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide
N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide (PubChem CID 5307337) has the molecular formula C13H17N3O3S
and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide |
| PubChem CID | 5307337 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide |
| SMILES | COCCCNC(=O)CN1C(=O)CSc2ncccc21 |
| InChI | InChI=1S/C13H17N3O3S/c1-19-7-3-6-14-11(17)8-16-10-4-2-5-15-13(10)20-9-12(16)18/h2,4-5H,3,6-9H2,1H3,(H,14,17) |
| InChIKey | CVUBEFASVMCIJQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide?
The IUPAC name of N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide (CID 5307337) is N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide.
What is the SMILES notation for N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide?
The canonical SMILES for N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide is COCCCNC(=O)CN1C(=O)CSc2ncccc21.
What is the InChIKey of N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide?
The InChIKey is CVUBEFASVMCIJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3S/c1-19-7-3-6-14-11(17)8-16-10-4-2-5-15-13(10)20-9-12(16)18/h2,4-5H,3,6-9H2,1H3,(H,14,17).
What are the key properties of N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide?
N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide has a molecular weight of 295.36 g/mol, XLogP of 0.67, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide is sourced from PubChem (CID 5307337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).