C17H19N3O4S — CID 53073383
2-[3-(benzenesulfonyl)-6-oxopyridazin-1-yl]-N-cyclopentylacetamide (PubChem CID 53073383) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)-6-oxopyridazin-1-yl]-N-cyclopentylacetamide.
| Compound Name | 2-[3-(benzenesulfonyl)-6-oxopyridazin-1-yl]-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 53073383 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[3-(benzenesulfonyl)-6-oxopyridazin-1-yl]-N-cyclopentylacetamide |
| SMILES | O=C(Cn1nc(S(=O)(=O)c2ccccc2)ccc1=O)NC1CCCC1 |
| InChI | InChI=1S/C17H19N3O4S/c21-15(18-13-6-4-5-7-13)12-20-17(22)11-10-16(19-20)25(23,24)14-8-2-1-3-9-14/h1-3,8-11,13H,4-7,12H2,(H,18,21) |
| InChIKey | HLFOSNVRZVTRET-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |