C19H25N3O3S — CID 53075266
5-cyclohexyl-3-(4-piperidin-1-ylsulfonylphenyl)-1,2,4-oxadiazole (PubChem CID 53075266) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 5-cyclohexyl-3-(4-piperidin-1-ylsulfonylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-cyclohexyl-3-(4-piperidin-1-ylsulfonylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 53075266 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 5-cyclohexyl-3-(4-piperidin-1-ylsulfonylphenyl)-1,2,4-oxadiazole |
| SMILES | O=S(=O)(c1ccc(-c2noc(C3CCCCC3)n2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H25N3O3S/c23-26(24,22-13-5-2-6-14-22)17-11-9-15(10-12-17)18-20-19(25-21-18)16-7-3-1-4-8-16/h9-12,16H,1-8,13-14H2 |
| InChIKey | JDEPRMWYBCAWHN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |