About N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride
N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride (PubChem CID 5307594) has the molecular formula C17H20ClN3O3
and a molecular weight of 349.82 g/mol. Its IUPAC name is N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride |
| PubChem CID | 5307594 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride |
| SMILES | COc1cc(CNc2nc3ccccc3[nH]2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C17H19N3O3.ClH/c1-21-14-8-11(9-15(22-2)16(14)23-3)10-18-17-19-12-6-4-5-7-13(12)20-17;/h4-9H,10H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | JDTPEXXSSJROLQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride?
The IUPAC name of N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride (CID 5307594) is N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride.
What is the SMILES notation for N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride?
The canonical SMILES for N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride is COc1cc(CNc2nc3ccccc3[nH]2)cc(OC)c1OC.Cl.
What is the InChIKey of N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride?
The InChIKey is JDTPEXXSSJROLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3.ClH/c1-21-14-8-11(9-15(22-2)16(14)23-3)10-18-17-19-12-6-4-5-7-13(12)20-17;/h4-9H,10H2,1-3H3,(H2,18,19,20);1H.
What are the key properties of N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride?
N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride has a molecular weight of 349.82 g/mol, XLogP of 3.62, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4,5-trimethoxyphenyl)methyl]-1H-benzimidazol-2-amine;hydrochloride is sourced from PubChem (CID 5307594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).