C25H28ClFN6O — CID 53076477
N-[(2-chloro-4-fluorophenyl)methyl]-3-[11-(3,4-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanamide (PubChem CID 53076477) has the molecular formula C25H28ClFN6O and a molecular weight of 482.99 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]-3-[11-(3,4-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanamide.
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]-3-[11-(3,4-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanamide |
|---|---|
| PubChem CID | 53076477 |
| Molecular Formula | C25H28ClFN6O |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]-3-[11-(3,4-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanamide |
| SMILES | Cc1ccc(C2CC3C4NN=C(CCC(=O)NCc5ccc(F)cc5Cl)N4C=CN3N2)cc1C |
| InChI | InChI=1S/C25H28ClFN6O/c1-15-3-4-17(11-16(15)2)21-13-22-25-30-29-23(32(25)9-10-33(22)31-21)7-8-24(34)28-14-18-5-6-19(27)12-20(18)26/h3-6,9-12,21-22,25,30-31H,7-8,13-14H2,1-2H3,(H,28,34) |
| InChIKey | STSXTWAVFSGQCE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |