C25H26N2O7S — CID 53077233
3-(3,4,5-trimethoxyphenyl)-5-[5-[(2,4,5-trimethylphenyl)sulfonylmethyl]furan-2-yl]-1,2,4-oxadiazole (PubChem CID 53077233) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)-5-[5-[(2,4,5-trimethylphenyl)sulfonylmethyl]furan-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)-5-[5-[(2,4,5-trimethylphenyl)sulfonylmethyl]furan-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 53077233 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)-5-[5-[(2,4,5-trimethylphenyl)sulfonylmethyl]furan-2-yl]-1,2,4-oxadiazole |
| SMILES | COc1cc(-c2noc(-c3ccc(CS(=O)(=O)c4cc(C)c(C)cc4C)o3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H26N2O7S/c1-14-9-16(3)22(10-15(14)2)35(28,29)13-18-7-8-19(33-18)25-26-24(27-34-25)17-11-20(30-4)23(32-6)21(12-17)31-5/h7-12H,13H2,1-6H3 |
| InChIKey | VJSARQNWMWEZAC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 113.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |