C24H28N2O3S — CID 5307732
4-benzyl-N-(2,3-dimethylcyclohexyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide (PubChem CID 5307732) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 4-benzyl-N-(2,3-dimethylcyclohexyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide.
| Compound Name | 4-benzyl-N-(2,3-dimethylcyclohexyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 5307732 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 4-benzyl-N-(2,3-dimethylcyclohexyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide |
| SMILES | CC1CCCC(NC(=O)c2ccc3c(c2)N(Cc2ccccc2)C(=O)CS3=O)C1C |
| InChI | InChI=1S/C24H28N2O3S/c1-16-7-6-10-20(17(16)2)25-24(28)19-11-12-22-21(13-19)26(23(27)15-30(22)29)14-18-8-4-3-5-9-18/h3-5,8-9,11-13,16-17,20H,6-7,10,14-15H2,1-2H3,(H,25,28) |
| InChIKey | WQUZYPVODOEGGI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |