About ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate
ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate (PubChem CID 5307747) has the molecular formula C20H25N5O4
and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate |
| PubChem CID | 5307747 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2c(N3CCN(c4ccccn4)CC3)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C20H25N5O4/c1-2-29-20(28)25-13-11-24(12-14-25)17-16(18(26)19(17)27)23-9-7-22(8-10-23)15-5-3-4-6-21-15/h3-6H,2,7-14H2,1H3 |
| InChIKey | HQXOSLPSKFHEQL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 86.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate (CID 5307747) is ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate is CCOC(=O)N1CCN(c2c(N3CCN(c4ccccn4)CC3)c(=O)c2=O)CC1.
What is the InChIKey of ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate?
The InChIKey is HQXOSLPSKFHEQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N5O4/c1-2-29-20(28)25-13-11-24(12-14-25)17-16(18(26)19(17)27)23-9-7-22(8-10-23)15-5-3-4-6-21-15/h3-6H,2,7-14H2,1H3.
What are the key properties of ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate?
ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate has a molecular weight of 399.45 g/mol, XLogP of 0.28, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3,4-dioxo-2-(4-pyridin-2-ylpiperazin-1-yl)cyclobuten-1-yl]piperazine-1-carboxylate is sourced from PubChem (CID 5307747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).