C21H25N5OS — CID 5307781
N-(3-phenylpropyl)-1-(5-pyrrol-1-yl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide (PubChem CID 5307781) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is N-(3-phenylpropyl)-1-(5-pyrrol-1-yl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | N-(3-phenylpropyl)-1-(5-pyrrol-1-yl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 5307781 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-(3-phenylpropyl)-1-(5-pyrrol-1-yl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCN(c2nnc(-n3cccc3)s2)CC1 |
| InChI | InChI=1S/C21H25N5OS/c27-19(22-12-6-9-17-7-2-1-3-8-17)18-10-15-26(16-11-18)21-24-23-20(28-21)25-13-4-5-14-25/h1-5,7-8,13-14,18H,6,9-12,15-16H2,(H,22,27) |
| InChIKey | COIURHSPZZRMIF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|