About 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide
2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide (PubChem CID 5307788) has the molecular formula C20H21N3O3
and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide |
| PubChem CID | 5307788 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide |
| SMILES | CC(CCc1ccco1)NC(=O)Cn1ncc2c1-c1ccccc1OC2 |
| InChI | InChI=1S/C20H21N3O3/c1-14(8-9-16-5-4-10-25-16)22-19(24)12-23-20-15(11-21-23)13-26-18-7-3-2-6-17(18)20/h2-7,10-11,14H,8-9,12-13H2,1H3,(H,22,24) |
| InChIKey | PJZGZFOFOWSCMY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide?
The IUPAC name of 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide (CID 5307788) is 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide.
What is the SMILES notation for 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide?
The canonical SMILES for 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide is CC(CCc1ccco1)NC(=O)Cn1ncc2c1-c1ccccc1OC2.
What is the InChIKey of 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide?
The InChIKey is PJZGZFOFOWSCMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O3/c1-14(8-9-16-5-4-10-25-16)22-19(24)12-23-20-15(11-21-23)13-26-18-7-3-2-6-17(18)20/h2-7,10-11,14H,8-9,12-13H2,1H3,(H,22,24).
What are the key properties of 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide?
2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide has a molecular weight of 351.41 g/mol, XLogP of 3.17, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide is sourced from PubChem (CID 5307788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).