C24H19ClN4O — CID 53078235
N-(4-chlorophenyl)-4-[[2-(4-methylphenyl)pyrimidin-4-yl]amino]benzamide (PubChem CID 53078235) has the molecular formula C24H19ClN4O and a molecular weight of 414.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[[2-(4-methylphenyl)pyrimidin-4-yl]amino]benzamide.
| Compound Name | N-(4-chlorophenyl)-4-[[2-(4-methylphenyl)pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 53078235 |
| Molecular Formula | C24H19ClN4O |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-(4-chlorophenyl)-4-[[2-(4-methylphenyl)pyrimidin-4-yl]amino]benzamide |
| SMILES | Cc1ccc(-c2nccc(Nc3ccc(C(=O)Nc4ccc(Cl)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C24H19ClN4O/c1-16-2-4-17(5-3-16)23-26-15-14-22(29-23)27-20-10-6-18(7-11-20)24(30)28-21-12-8-19(25)9-13-21/h2-15H,1H3,(H,28,30)(H,26,27,29) |
| InChIKey | JEALQRZPXXJOJQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |