C24H18ClFN4O — CID 53078306
N-[(2-chlorophenyl)methyl]-4-[[2-(3-fluorophenyl)pyrimidin-4-yl]amino]benzamide (PubChem CID 53078306) has the molecular formula C24H18ClFN4O and a molecular weight of 432.89 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-[[2-(3-fluorophenyl)pyrimidin-4-yl]amino]benzamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-[[2-(3-fluorophenyl)pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 53078306 |
| Molecular Formula | C24H18ClFN4O |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-[[2-(3-fluorophenyl)pyrimidin-4-yl]amino]benzamide |
| SMILES | O=C(NCc1ccccc1Cl)c1ccc(Nc2ccnc(-c3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C24H18ClFN4O/c25-21-7-2-1-4-18(21)15-28-24(31)16-8-10-20(11-9-16)29-22-12-13-27-23(30-22)17-5-3-6-19(26)14-17/h1-14H,15H2,(H,28,31)(H,27,29,30) |
| InChIKey | XQRFBXQEAIZJOF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |