About 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole
5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole (PubChem CID 53078408) has the molecular formula C18H16ClF2N3O3S
and a molecular weight of 427.86 g/mol. Its IUPAC name is 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole |
| PubChem CID | 53078408 |
| Molecular Formula | C18H16ClF2N3O3S |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1CCN(Cc2nc3cc(Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C18H16ClF2N3O3S/c19-12-1-4-17-16(9-12)22-18(27-17)11-23-5-7-24(8-6-23)28(25,26)13-2-3-14(20)15(21)10-13/h1-4,9-10H,5-8,11H2 |
| InChIKey | PQTVUYXMDIFJOR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole?
The IUPAC name of 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole (CID 53078408) is 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole.
What is the SMILES notation for 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole?
The canonical SMILES for 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole is O=S(=O)(c1ccc(F)c(F)c1)N1CCN(Cc2nc3cc(Cl)ccc3o2)CC1.
What is the InChIKey of 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole?
The InChIKey is PQTVUYXMDIFJOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClF2N3O3S/c19-12-1-4-17-16(9-12)22-18(27-17)11-23-5-7-24(8-6-23)28(25,26)13-2-3-14(20)15(21)10-13/h1-4,9-10H,5-8,11H2.
What are the key properties of 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole?
5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole has a molecular weight of 427.86 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-benzoxazole is sourced from PubChem (CID 53078408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).