About (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine
(E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine (PubChem CID 5307865) has the molecular formula C18H24N4O3S
and a molecular weight of 376.48 g/mol. Its IUPAC name is (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine.
Molecular Properties
| Compound Name | (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine |
| PubChem CID | 5307865 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine |
| SMILES | Cc1noc(/C=C/N(C)C)c1S(=O)(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H24N4O3S/c1-15-18(17(25-19-15)9-10-20(2)3)26(23,24)22-13-11-21(12-14-22)16-7-5-4-6-8-16/h4-10H,11-14H2,1-3H3/b10-9+ |
| InChIKey | GKHJQSMCPZTCKJ-MDZDMXLPSA-N |
| XLogP | 2.03 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine?
The IUPAC name of (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine (CID 5307865) is (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine.
What is the SMILES notation for (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine?
The canonical SMILES for (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine is Cc1noc(/C=C/N(C)C)c1S(=O)(=O)N1CCN(c2ccccc2)CC1.
What is the InChIKey of (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine?
The InChIKey is GKHJQSMCPZTCKJ-MDZDMXLPSA-N. The full InChI is InChI=1S/C18H24N4O3S/c1-15-18(17(25-19-15)9-10-20(2)3)26(23,24)22-13-11-21(12-14-22)16-7-5-4-6-8-16/h4-10H,11-14H2,1-3H3/b10-9+.
What are the key properties of (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine?
(E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine has a molecular weight of 376.48 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-dimethyl-2-[3-methyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,2-oxazol-5-yl]ethenamine is sourced from PubChem (CID 5307865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).