C20H22ClN3O — CID 5307876
2-(4-chlorophenyl)-3-[4-(dimethylamino)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one (PubChem CID 5307876) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-[4-(dimethylamino)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one.
| Compound Name | 2-(4-chlorophenyl)-3-[4-(dimethylamino)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
|---|---|
| PubChem CID | 5307876 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-(4-chlorophenyl)-3-[4-(dimethylamino)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
| SMILES | CN(C)c1ccc(C2N(c3ccc(Cl)cc3)C(=O)C3CCCN32)cc1 |
| InChI | InChI=1S/C20H22ClN3O/c1-22(2)16-9-5-14(6-10-16)19-23-13-3-4-18(23)20(25)24(19)17-11-7-15(21)8-12-17/h5-12,18-19H,3-4,13H2,1-2H3 |
| InChIKey | WHROPULETMQIIT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|