C10H12N4S — CID 5307972
2-N-benzyl-2-N-methyl-1,3,4-thiadiazole-2,5-diamine (PubChem CID 5307972) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-N-benzyl-2-N-methyl-1,3,4-thiadiazole-2,5-diamine.
| Compound Name | 2-N-benzyl-2-N-methyl-1,3,4-thiadiazole-2,5-diamine |
|---|---|
| PubChem CID | 5307972 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-N-benzyl-2-N-methyl-1,3,4-thiadiazole-2,5-diamine |
| SMILES | CN(Cc1ccccc1)c1nnc(N)s1 |
| InChI | InChI=1S/C10H12N4S/c1-14(10-13-12-9(11)15-10)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H2,11,12) |
| InChIKey | CTQCLNBVYPTZLZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |