C25H31N5O4S — CID 53079912
ethyl 2-[1-[[4-(4-methoxyphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]cyclohexyl]acetate (PubChem CID 53079912) has the molecular formula C25H31N5O4S and a molecular weight of 497.62 g/mol. Its IUPAC name is ethyl 2-[1-[[4-(4-methoxyphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]cyclohexyl]acetate.
| Compound Name | ethyl 2-[1-[[4-(4-methoxyphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]cyclohexyl]acetate |
|---|---|
| PubChem CID | 53079912 |
| Molecular Formula | C25H31N5O4S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | ethyl 2-[1-[[4-(4-methoxyphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1(NC(=O)N2CCc3c(sc4nc(-c5ccc(OC)cc5)nn34)C2)CCCCC1 |
| InChI | InChI=1S/C25H31N5O4S/c1-3-34-21(31)15-25(12-5-4-6-13-25)27-23(32)29-14-11-19-20(16-29)35-24-26-22(28-30(19)24)17-7-9-18(33-2)10-8-17/h7-10H,3-6,11-16H2,1-2H3,(H,27,32) |
| InChIKey | AFEJIEOGHOFTRQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |