C18H20FN5O2S — CID 53080002
4-(4-fluorophenyl)-N-(3-methoxypropyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide (PubChem CID 53080002) has the molecular formula C18H20FN5O2S and a molecular weight of 389.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(3-methoxypropyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-(3-methoxypropyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
|---|---|
| PubChem CID | 53080002 |
| Molecular Formula | C18H20FN5O2S |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(3-methoxypropyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
| SMILES | COCCCNC(=O)N1CCc2c(sc3nc(-c4ccc(F)cc4)nn23)C1 |
| InChI | InChI=1S/C18H20FN5O2S/c1-26-10-2-8-20-17(25)23-9-7-14-15(11-23)27-18-21-16(22-24(14)18)12-3-5-13(19)6-4-12/h3-6H,2,7-11H2,1H3,(H,20,25) |
| InChIKey | CAWOBGYIGOUTNM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|