C24H28FN5O3S — CID 53080014
ethyl 2-[1-[[4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]cyclohexyl]acetate (PubChem CID 53080014) has the molecular formula C24H28FN5O3S and a molecular weight of 485.59 g/mol. Its IUPAC name is ethyl 2-[1-[[4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]cyclohexyl]acetate.
| Compound Name | ethyl 2-[1-[[4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]cyclohexyl]acetate |
|---|---|
| PubChem CID | 53080014 |
| Molecular Formula | C24H28FN5O3S |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | ethyl 2-[1-[[4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1(NC(=O)N2CCc3c(sc4nc(-c5ccc(F)cc5)nn34)C2)CCCCC1 |
| InChI | InChI=1S/C24H28FN5O3S/c1-2-33-20(31)14-24(11-4-3-5-12-24)27-22(32)29-13-10-18-19(15-29)34-23-26-21(28-30(18)23)16-6-8-17(25)9-7-16/h6-9H,2-5,10-15H2,1H3,(H,27,32) |
| InChIKey | ZCKCFNVVECAVHN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |