About N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 5308012) has the molecular formula C17H17ClN4O2
and a molecular weight of 344.80 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 5308012 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1noc(C(=O)Nc2c(C)nn(Cc3ccccc3)c2C)c1Cl |
| InChI | InChI=1S/C17H17ClN4O2/c1-10-14(18)16(24-21-10)17(23)19-15-11(2)20-22(12(15)3)9-13-7-5-4-6-8-13/h4-8H,9H2,1-3H3,(H,19,23) |
| InChIKey | ZLOIXOCJCZQADM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide (CID 5308012) is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide is Cc1noc(C(=O)Nc2c(C)nn(Cc3ccccc3)c2C)c1Cl.
What is the InChIKey of N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide?
The InChIKey is ZLOIXOCJCZQADM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN4O2/c1-10-14(18)16(24-21-10)17(23)19-15-11(2)20-22(12(15)3)9-13-7-5-4-6-8-13/h4-8H,9H2,1-3H3,(H,19,23).
What are the key properties of N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide?
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide has a molecular weight of 344.80 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chloro-3-methyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 5308012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).