C15H24F2OSi — CID 530803
(3,5-difluorophenoxy)-tripropylsilane (PubChem CID 530803) has the molecular formula C15H24F2OSi and a molecular weight of 286.44 g/mol. Its IUPAC name is (3,5-difluorophenoxy)-tripropylsilane.
| Compound Name | (3,5-difluorophenoxy)-tripropylsilane |
|---|---|
| PubChem CID | 530803 |
| Molecular Formula | C15H24F2OSi |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (3,5-difluorophenoxy)-tripropylsilane |
| SMILES | CCC[Si](CCC)(CCC)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H24F2OSi/c1-4-7-19(8-5-2,9-6-3)18-15-11-13(16)10-14(17)12-15/h10-12H,4-9H2,1-3H3 |
| InChIKey | CETBUVYKDWOJCM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|