C21H24N2O3S — CID 5308108
4-benzyl-N-(3-methylbutyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide (PubChem CID 5308108) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-benzyl-N-(3-methylbutyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide.
| Compound Name | 4-benzyl-N-(3-methylbutyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 5308108 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-benzyl-N-(3-methylbutyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide |
| SMILES | CC(C)CCNC(=O)c1ccc2c(c1)N(Cc1ccccc1)C(=O)CS2=O |
| InChI | InChI=1S/C21H24N2O3S/c1-15(2)10-11-22-21(25)17-8-9-19-18(12-17)23(20(24)14-27(19)26)13-16-6-4-3-5-7-16/h3-9,12,15H,10-11,13-14H2,1-2H3,(H,22,25) |
| InChIKey | RZZVAOLSZHVGNM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |