About 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine
5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine (PubChem CID 53082546) has the molecular formula C25H21N5OS
and a molecular weight of 439.54 g/mol. Its IUPAC name is 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine.
Molecular Properties
| Compound Name | 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine |
| PubChem CID | 53082546 |
| Molecular Formula | C25H21N5OS |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine |
| SMILES | Cc1ccc(-c2csc(-c3nnn(-c4ccc(OCc5ccccc5)cc4)c3N)n2)cc1 |
| InChI | InChI=1S/C25H21N5OS/c1-17-7-9-19(10-8-17)22-16-32-25(27-22)23-24(26)30(29-28-23)20-11-13-21(14-12-20)31-15-18-5-3-2-4-6-18/h2-14,16H,15,26H2,1H3 |
| InChIKey | LLXBNVGTPLXOAC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine?
The IUPAC name of 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine (CID 53082546) is 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine.
What is the SMILES notation for 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine?
The canonical SMILES for 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine is Cc1ccc(-c2csc(-c3nnn(-c4ccc(OCc5ccccc5)cc4)c3N)n2)cc1.
What is the InChIKey of 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine?
The InChIKey is LLXBNVGTPLXOAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N5OS/c1-17-7-9-19(10-8-17)22-16-32-25(27-22)23-24(26)30(29-28-23)20-11-13-21(14-12-20)31-15-18-5-3-2-4-6-18/h2-14,16H,15,26H2,1H3.
What are the key properties of 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine?
5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine has a molecular weight of 439.54 g/mol, XLogP of 5.53, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)triazol-4-amine is sourced from PubChem (CID 53082546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).