About (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone
(2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 5308255) has the molecular formula C22H25N5OS
and a molecular weight of 407.54 g/mol. Its IUPAC name is (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| PubChem CID | 5308255 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc2nc(N3CCCCC3)sc2c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H25N5OS/c28-21(26-14-12-25(13-15-26)20-6-2-3-9-23-20)17-7-8-18-19(16-17)29-22(24-18)27-10-4-1-5-11-27/h2-3,6-9,16H,1,4-5,10-15H2 |
| InChIKey | WWXGUANLVAIXOE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The IUPAC name of (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone (CID 5308255) is (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone.
What is the SMILES notation for (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The canonical SMILES for (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone is O=C(c1ccc2nc(N3CCCCC3)sc2c1)N1CCN(c2ccccn2)CC1.
What is the InChIKey of (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The InChIKey is WWXGUANLVAIXOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5OS/c28-21(26-14-12-25(13-15-26)20-6-2-3-9-23-20)17-7-8-18-19(16-17)29-22(24-18)27-10-4-1-5-11-27/h2-3,6-9,16H,1,4-5,10-15H2.
What are the key properties of (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone?
(2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone has a molecular weight of 407.54 g/mol, XLogP of 3.64, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-piperidin-1-yl-1,3-benzothiazol-6-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 5308255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).