About N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide
N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide (PubChem CID 5308310) has the molecular formula C23H25N3O5S
and a molecular weight of 455.54 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide.
Molecular Properties
| Compound Name | N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide |
| PubChem CID | 5308310 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN(S(=O)(=O)c3cccc4cccnc34)C2)cc1OC |
| InChI | InChI=1S/C23H25N3O5S/c1-30-19-11-10-18(14-20(19)31-2)25-23(27)17-8-5-13-26(15-17)32(28,29)21-9-3-6-16-7-4-12-24-22(16)21/h3-4,6-7,9-12,14,17H,5,8,13,15H2,1-2H3,(H,25,27) |
| InChIKey | DYKWEDBDEJYMHJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide?
The IUPAC name of N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide (CID 5308310) is N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide.
What is the SMILES notation for N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide?
The canonical SMILES for N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide is COc1ccc(NC(=O)C2CCCN(S(=O)(=O)c3cccc4cccnc34)C2)cc1OC.
What is the InChIKey of N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide?
The InChIKey is DYKWEDBDEJYMHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O5S/c1-30-19-11-10-18(14-20(19)31-2)25-23(27)17-8-5-13-26(15-17)32(28,29)21-9-3-6-16-7-4-12-24-22(16)21/h3-4,6-7,9-12,14,17H,5,8,13,15H2,1-2H3,(H,25,27).
What are the key properties of N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide?
N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide has a molecular weight of 455.54 g/mol, XLogP of 3.29, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethoxyphenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide is sourced from PubChem (CID 5308310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).