About 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide
2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide (PubChem CID 5308343) has the molecular formula C18H18N2O3
and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide.
Molecular Properties
| Compound Name | 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide |
| PubChem CID | 5308343 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide |
| SMILES | O=C(CC1Oc2ccccc2NC1=O)NCCc1ccccc1 |
| InChI | InChI=1S/C18H18N2O3/c21-17(19-11-10-13-6-2-1-3-7-13)12-16-18(22)20-14-8-4-5-9-15(14)23-16/h1-9,16H,10-12H2,(H,19,21)(H,20,22) |
| InChIKey | XCVVJPHLAOAWHE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide?
The IUPAC name of 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide (CID 5308343) is 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide.
What is the SMILES notation for 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide?
The canonical SMILES for 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide is O=C(CC1Oc2ccccc2NC1=O)NCCc1ccccc1.
What is the InChIKey of 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide?
The InChIKey is XCVVJPHLAOAWHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O3/c21-17(19-11-10-13-6-2-1-3-7-13)12-16-18(22)20-14-8-4-5-9-15(14)23-16/h1-9,16H,10-12H2,(H,19,21)(H,20,22).
What are the key properties of 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide?
2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide has a molecular weight of 310.35 g/mol, XLogP of 2.14, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-phenylethyl)acetamide is sourced from PubChem (CID 5308343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).