C23H24F5N5O3 — CID 53084021
6-N-cyclopentyl-6-methyl-8-oxo-1-N-(2,3,4,5,6-pentafluorophenyl)-7-propyl-5H-imidazo[1,5-a]pyrazine-1,6-dicarboxamide (PubChem CID 53084021) has the molecular formula C23H24F5N5O3 and a molecular weight of 513.47 g/mol. Its IUPAC name is 6-N-cyclopentyl-6-methyl-8-oxo-1-N-(2,3,4,5,6-pentafluorophenyl)-7-propyl-5H-imidazo[1,5-a]pyrazine-1,6-dicarboxamide.
| Compound Name | 6-N-cyclopentyl-6-methyl-8-oxo-1-N-(2,3,4,5,6-pentafluorophenyl)-7-propyl-5H-imidazo[1,5-a]pyrazine-1,6-dicarboxamide |
|---|---|
| PubChem CID | 53084021 |
| Molecular Formula | C23H24F5N5O3 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 6-N-cyclopentyl-6-methyl-8-oxo-1-N-(2,3,4,5,6-pentafluorophenyl)-7-propyl-5H-imidazo[1,5-a]pyrazine-1,6-dicarboxamide |
| SMILES | CCCN1C(=O)c2c(C(=O)Nc3c(F)c(F)c(F)c(F)c3F)ncn2CC1(C)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C23H24F5N5O3/c1-3-8-33-21(35)19-18(20(34)31-17-15(27)13(25)12(24)14(26)16(17)28)29-10-32(19)9-23(33,2)22(36)30-11-6-4-5-7-11/h10-11H,3-9H2,1-2H3,(H,30,36)(H,31,34) |
| InChIKey | GDPAHUYPKAZRIU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|