C13H13N5 — CID 5308442
N-(2-phenylethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 5308442) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is N-(2-phenylethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(2-phenylethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 5308442 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-(2-phenylethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | c1ccc(CCNc2ccc3nncn3n2)cc1 |
| InChI | InChI=1S/C13H13N5/c1-2-4-11(5-3-1)8-9-14-12-6-7-13-16-15-10-18(13)17-12/h1-7,10H,8-9H2,(H,14,17) |
| InChIKey | LVLIMPYYRIAXBX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |