About 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide
4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide (PubChem CID 5308457) has the molecular formula C21H18N2O4S
and a molecular weight of 394.45 g/mol. Its IUPAC name is 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide.
Molecular Properties
| Compound Name | 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide |
| PubChem CID | 5308457 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide |
| SMILES | O=C(NCc1ccco1)c1ccc2c(c1)N(Cc1ccccc1)C(=O)CS2=O |
| InChI | InChI=1S/C21H18N2O4S/c24-20-14-28(26)19-9-8-16(21(25)22-12-17-7-4-10-27-17)11-18(19)23(20)13-15-5-2-1-3-6-15/h1-11H,12-14H2,(H,22,25) |
| InChIKey | PHVAJIVVGPFZCI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide?
The IUPAC name of 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide (CID 5308457) is 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide.
What is the SMILES notation for 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide?
The canonical SMILES for 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide is O=C(NCc1ccco1)c1ccc2c(c1)N(Cc1ccccc1)C(=O)CS2=O.
What is the InChIKey of 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide?
The InChIKey is PHVAJIVVGPFZCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4S/c24-20-14-28(26)19-9-8-16(21(25)22-12-17-7-4-10-27-17)11-18(19)23(20)13-15-5-2-1-3-6-15/h1-11H,12-14H2,(H,22,25).
What are the key properties of 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide?
4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide has a molecular weight of 394.45 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-N-(furan-2-ylmethyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide is sourced from PubChem (CID 5308457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).